Maltotriose
Product Description
Chemical Name:Maltotriose
CAS Number:1109-28-0
CAS Number:1109-28-0
Model Number:YHBT-MT-03 | Structure: |
Chemical Name:Maltotriose | CAS Number:1109-28-0 |
Molecular formula:C18H32O16 | Mol. Weight:504.4 g/mol |
Purity:HPLC≥98% | Appearance:White to Off-White Solid |
Synonym: α-D-Glc-(1→4)-α-D-Glc-(1→4)-D-Glc O-α-DD-Glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-D-glucose | IUPAC Name: |
InChI:1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17-,18-/m1/s1 | InChI Key: FYGDTMLNYKFZSV-PXXRMHSHSA-N |
Isomeric SMILES:C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)CO)O)O)O)O | SMILES:C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)O)CO)CO)O)O)O)O |
Canonical SMILES:C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC(C(CO)O)C(C(C=O)O)O)CO)O)O)O)O | Category:Carbohydrates |
Solubility: water: 50 mg/ml | Storage condition:room temp |
Packing: |
Application:
1. Maltotriose can enhance sweetness and improve texture in food products. Due to its moisturizing properties, it can extend the shelf life of food and maintain moisture in products. It can also be used to treat constipation, regulate intestinal flora, and improve gastrointestinal function.
2. Maltotriose can be used as an excipient in pharmaceutical formulations.
3. It can be used in cosmetics such as creams, lotions, and body milk.
4. Maltotriose can also be used in microbiological culture media, enzyme, and antibiotic production.