Maltohexaose
CAS Number:34620-77-4
Model Number:YHBT-MT-06 | Structure: |
Chemical Name:Maltohexaose | CAS Number:34620-77-4 |
Molecular formula:C36H62O31 | Mol. Weight:990.86 |
Purity:≥99.0% | Appearance:White power |
Synonym: | IUPAC Name: |
InChI:1S/C36H62O31/c37-1-7-13(43)14(44)21(51)32(58-7)64-27-9(3-39)60-34(23(53)16(27)46)66-29-11(5-41)62-36(25(55)18(29)48)67-30-12(6-42)61-35(24(54)19(30)49)65-28-10(4-40)59-33(22(52)17(28)47)63-26-8(2-38)57-31(56)20(50)15(26)45/h7-56H,1-6H2/t7-,8-,9-,10-,11-,12-,13-,14+,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31?,32-,33-,34-,35-,36-/m1/s1 | InChI Key: OCIBBXPLUVYKCH-LIGGPISVSA-N |
Isomeric SMILES: | SMILES:OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O[C@@H]2CO)O[C@H]3[C@H](O)[C@@H](O)[C@H](O[C@@H]3CO)O[C@H]4[C@H](O)[C@@H](O)[C@H](O[C@@H]4CO)O[C@H]5[C@H](O)[C@@H](O)[C@H](O[C@@H]5CO)O[C@H]6[C@H](O)[C@@H](O)C(O)O[C@@H]6CO)[C@H](O)[C@@H](O)[C@@H]1O |
Canonical SMILES: | Category:carbohydrates |
Solubility: water: 50 mg/mL | Storage condition:room temp |
Packing: |
Application:
1. Used as a sweetener, flavor modifier, anti-crystallization agent, stabilizer, and fermentation promoter; can be used as a raw material for health food, to regulate intestinal flora and improve intestinal health.
2. In pharmaceutical formulations, maltose can be used as an excipient; the chemical structure of maltose contains multiple hydroxyl groups, which can be used as raw materials for drug synthesis, participating in some drug synthesis reactions, and providing new ideas and methods for drug development; in the diagnosis of diabetes, maltose can be used to test the patient's glucose tolerance, helping doctors to judge the patient's blood sugar regulation ability.
3. In cosmetics, maltose can be used as a moisturizer, antioxidant, etc.