D-(+)-Cellobiose
Product Description
Chemical Name:D-(+)-Cellobiose
CAS Number:528-50-7
CAS Number:528-50-7
Model Number:YHBT-DXT-02 | Structure: |
Chemical Name:D-(+)-Cellobiose | CAS Number:528-50-7 |
Molecular formula:C12H22O11 | Mol. Weight:342.30 |
Purity:HPLC≥99.0% | Appearance:crystalline solid |
Synonym:4 O beta D Glucopyranosyl D glucopyranose; 4-O-beta-D-Glucopyranosyl-D-glucopyranose Cellobiose | IUPAC Name:(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
InChI:InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11-,12+/m1/s1 | InChI Key:DKXNBNKWCZZMJT-WELRSGGNSA-N |
Isomeric SMILES:C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O | SMILES:C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
Canonical SMILES:C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | Category:Carbohydrates |
Solubility: 111.0 mg/ mL (15 °C) | Storage condition:RT |
Packing: |
Application:
1. Used as a sweetener and has a certain preservative effect, extending the shelf life of food. It can also improve the taste, texture, and preservability of food, increase the viscosity and stability of food, and make the taste of food more rich and delicate.
2. Can be used in pharmaceutical research to prevent and treat digestive system diseases, high blood lipids, diabetes, etc.
3. Can be used in the study of enzyme kinetics and characteristics.